About pentan-3-yl carbamodithioate
pentan-3-yl carbamodithioate (PubChem CID 87590917) has the molecular formula C6H13NS2
and a molecular weight of 163.31 g/mol. Its IUPAC name is pentan-3-yl carbamodithioate.
Molecular Properties
| Compound Name | pentan-3-yl carbamodithioate |
| PubChem CID | 87590917 |
| Molecular Formula | C6H13NS2 |
| Molecular Weight | 163.31 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | pentan-3-yl carbamodithioate |
| SMILES | CCC(CC)SC(N)=S |
| InChI | InChI=1S/C6H13NS2/c1-3-5(4-2)9-6(7)8/h5H,3-4H2,1-2H3,(H2,7,8) |
| InChIKey | ZVBSXFGAZCJJNE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pentan-3-yl carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-yl carbamodithioate?
The IUPAC name of pentan-3-yl carbamodithioate (CID 87590917) is pentan-3-yl carbamodithioate.
What is the SMILES notation for pentan-3-yl carbamodithioate?
The canonical SMILES for pentan-3-yl carbamodithioate is CCC(CC)SC(N)=S.
What is the InChIKey of pentan-3-yl carbamodithioate?
The InChIKey is ZVBSXFGAZCJJNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NS2/c1-3-5(4-2)9-6(7)8/h5H,3-4H2,1-2H3,(H2,7,8).
What are the key properties of pentan-3-yl carbamodithioate?
pentan-3-yl carbamodithioate has a molecular weight of 163.31 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-yl carbamodithioate is sourced from PubChem (CID 87590917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).