About disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate
disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate (PubChem CID 87591191) has the molecular formula C11H8N2Na2O7S2
and a molecular weight of 390.31 g/mol. Its IUPAC name is disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate.
Molecular Properties
| Compound Name | disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate |
| PubChem CID | 87591191 |
| Molecular Formula | C11H8N2Na2O7S2 |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate |
| SMILES | NC(=O)Nc1cc(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])ccc12.[Na+].[Na+] |
| InChI | InChI=1S/C11H10N2O7S2.2Na/c12-11(14)13-10-5-8(22(18,19)20)4-6-3-7(21(15,16)17)1-2-9(6)10;;/h1-5H,(H3,12,13,14)(H,15,16,17)(H,18,19,20);;/q;2*+1/p-2 |
| InChIKey | RFBCOHGUPOQTEF-UHFFFAOYSA-L |
| XLogP | -5.85 |
| TPSA | 169.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | -5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate?
The IUPAC name of disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate (CID 87591191) is disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate.
What is the SMILES notation for disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate?
The canonical SMILES for disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate is NC(=O)Nc1cc(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])ccc12.[Na+].[Na+].
What is the InChIKey of disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate?
The InChIKey is RFBCOHGUPOQTEF-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H10N2O7S2.2Na/c12-11(14)13-10-5-8(22(18,19)20)4-6-3-7(21(15,16)17)1-2-9(6)10;;/h1-5H,(H3,12,13,14)(H,15,16,17)(H,18,19,20);;/q;2*+1/p-2.
What are the key properties of disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate?
disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate has a molecular weight of 390.31 g/mol, XLogP of -5.85, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;4-(carbamoylamino)naphthalene-2,7-disulfonate is sourced from PubChem (CID 87591191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).