About (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene
(1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene (PubChem CID 87592312) has the molecular formula C14H15N5O2S
and a molecular weight of 317.37 g/mol. Its IUPAC name is (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene.
Molecular Properties
| Compound Name | (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene |
| PubChem CID | 87592312 |
| Molecular Formula | C14H15N5O2S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene |
| SMILES | Cc1c(/N=N/C2SC([N+](=O)[O-])=CN2C)c2ccccc2n1C |
| InChI | InChI=1S/C14H15N5O2S/c1-9-13(10-6-4-5-7-11(10)18(9)3)15-16-14-17(2)8-12(22-14)19(20)21/h4-8,14H,1-3H3/b16-15+ |
| InChIKey | IYIVOFPDEWRKHR-FOCLMDBBSA-N |
| XLogP | 3.61 |
| TPSA | 76.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene?
The IUPAC name of (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene (CID 87592312) is (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene.
What is the SMILES notation for (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene?
The canonical SMILES for (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene is Cc1c(/N=N/C2SC([N+](=O)[O-])=CN2C)c2ccccc2n1C.
What is the InChIKey of (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene?
The InChIKey is IYIVOFPDEWRKHR-FOCLMDBBSA-N. The full InChI is InChI=1S/C14H15N5O2S/c1-9-13(10-6-4-5-7-11(10)18(9)3)15-16-14-17(2)8-12(22-14)19(20)21/h4-8,14H,1-3H3/b16-15+.
What are the key properties of (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene?
(1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene has a molecular weight of 317.37 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-2H-1,3-thiazol-2-yl)diazene is sourced from PubChem (CID 87592312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).