C24H27ClN2O4 — CID 87592367
4-[(Z)-(5-ethyl-8,9-dihydro-7H-phenanthridin-5-ium-10-ylidene)methyl]-N,N-dimethylaniline perchlorate (PubChem CID 87592367) has the molecular formula C24H27ClN2O4 and a molecular weight of 442.94 g/mol. Its IUPAC name is 4-[(Z)-(5-ethyl-8,9-dihydro-7H-phenanthridin-5-ium-10-ylidene)methyl]-N,N-dimethylaniline perchlorate.
| Compound Name | 4-[(Z)-(5-ethyl-8,9-dihydro-7H-phenanthridin-5-ium-10-ylidene)methyl]-N,N-dimethylaniline perchlorate |
|---|---|
| PubChem CID | 87592367 |
| Molecular Formula | C24H27ClN2O4 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 4-[(Z)-(5-ethyl-8,9-dihydro-7H-phenanthridin-5-ium-10-ylidene)methyl]-N,N-dimethylaniline perchlorate |
| SMILES | CC[n+]1cc2c(c3ccccc31)/C(=C\c1ccc(N(C)C)cc1)CCC2.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H27N2.ClHO4/c1-4-26-17-20-9-7-8-19(24(20)22-10-5-6-11-23(22)26)16-18-12-14-21(15-13-18)25(2)3;2-1(3,4)5/h5-6,10-17H,4,7-9H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | GZWZBZYTFIEKSF-UHFFFAOYSA-M |
| XLogP | 0.33 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|