C12H8F6O15 — CID 87592834
4-[3-carboxy-2,3-dihydroxy-2-(2,2,2-trifluoroacetyl)oxypropanoyl]oxy-2,3-dihydroxy-4-oxo-3-(2,2,2-trifluoroacetyl)oxybutanoic acid (PubChem CID 87592834) has the molecular formula C12H8F6O15 and a molecular weight of 506.17 g/mol. Its IUPAC name is 4-[3-carboxy-2,3-dihydroxy-2-(2,2,2-trifluoroacetyl)oxypropanoyl]oxy-2,3-dihydroxy-4-oxo-3-(2,2,2-trifluoroacetyl)oxybutanoic acid.
| Compound Name | 4-[3-carboxy-2,3-dihydroxy-2-(2,2,2-trifluoroacetyl)oxypropanoyl]oxy-2,3-dihydroxy-4-oxo-3-(2,2,2-trifluoroacetyl)oxybutanoic acid |
|---|---|
| PubChem CID | 87592834 |
| Molecular Formula | C12H8F6O15 |
| Molecular Weight | 506.17 g/mol |
| Exact Mass | 505.98 |
| IUPAC Name | 4-[3-carboxy-2,3-dihydroxy-2-(2,2,2-trifluoroacetyl)oxypropanoyl]oxy-2,3-dihydroxy-4-oxo-3-(2,2,2-trifluoroacetyl)oxybutanoic acid |
| SMILES | O=C(O)C(O)C(O)(OC(=O)C(F)(F)F)C(=O)OC(=O)C(O)(OC(=O)C(F)(F)F)C(O)C(=O)O |
| InChI | InChI=1S/C12H8F6O15/c13-11(14,15)7(27)32-9(29,1(19)3(21)22)5(25)31-6(26)10(30,2(20)4(23)24)33-8(28)12(16,17)18/h1-2,19-20,29-30H,(H,21,22)(H,23,24) |
| InChIKey | FERXOGAAWHDQQO-UHFFFAOYSA-N |
| XLogP | -3.46 |
| TPSA | 251.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.17 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|