C6H3F3O7 — CID 87592835
[(3S)-3,4-dihydroxy-2,5-dioxooxolan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 87592835) has the molecular formula C6H3F3O7 and a molecular weight of 244.08 g/mol. Its IUPAC name is [(3S)-3,4-dihydroxy-2,5-dioxooxolan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(3S)-3,4-dihydroxy-2,5-dioxooxolan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87592835 |
| Molecular Formula | C6H3F3O7 |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | [(3S)-3,4-dihydroxy-2,5-dioxooxolan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C1OC(=O)[C@@](O)(OC(=O)C(F)(F)F)C1O |
| InChI | InChI=1S/C6H3F3O7/c7-6(8,9)4(13)16-5(14)1(10)2(11)15-3(5)12/h1,10,14H/t1?,5-/m0/s1 |
| InChIKey | DDPXRRBRDYNQNQ-LFEODUDPSA-N |
| XLogP | -1.78 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|