C26H24N2O2 — CID 87592910
(2E,4E)-5-[3-cyano-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-6-yl]penta-2,4-dienoic acid (PubChem CID 87592910) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is (2E,4E)-5-[3-cyano-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-6-yl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[3-cyano-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-6-yl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 87592910 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (2E,4E)-5-[3-cyano-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-6-yl]penta-2,4-dienoic acid |
| SMILES | Cc1ccc(-c2c(C#N)c(CC(C)C)nc3ccc(/C=C/C=C/C(=O)O)cc23)cc1 |
| InChI | InChI=1S/C26H24N2O2/c1-17(2)14-24-22(16-27)26(20-11-8-18(3)9-12-20)21-15-19(10-13-23(21)28-24)6-4-5-7-25(29)30/h4-13,15,17H,14H2,1-3H3,(H,29,30)/b6-4+,7-5+ |
| InChIKey | PFKPKMYVOYZMJG-YDFGWWAZSA-N |
| XLogP | 5.93 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|