About 1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one
1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one (PubChem CID 87593225) has the molecular formula C25H54O5Si2
and a molecular weight of 490.87 g/mol. Its IUPAC name is 1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one.
Molecular Properties
| Compound Name | 1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one |
| PubChem CID | 87593225 |
| Molecular Formula | C25H54O5Si2 |
| Molecular Weight | 490.87 g/mol |
| Exact Mass | 490.35 |
| IUPAC Name | 1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one |
| SMILES | CCO[Si](C)(CCCCCC(C)C(=O)C(C)CCCCC[Si](C)(OCC)OCC)OCC |
| InChI | InChI=1S/C25H54O5Si2/c1-9-27-31(7,28-10-2)21-17-13-15-19-23(5)25(26)24(6)20-16-14-18-22-32(8,29-11-3)30-12-4/h23-24H,9-22H2,1-8H3 |
| InChIKey | WIWNVOBNOPARGR-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.87 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one?
The IUPAC name of 1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one (CID 87593225) is 1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one.
What is the SMILES notation for 1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one?
The canonical SMILES for 1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one is CCO[Si](C)(CCCCCC(C)C(=O)C(C)CCCCC[Si](C)(OCC)OCC)OCC.
What is the InChIKey of 1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one?
The InChIKey is WIWNVOBNOPARGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H54O5Si2/c1-9-27-31(7,28-10-2)21-17-13-15-19-23(5)25(26)24(6)20-16-14-18-22-32(8,29-11-3)30-12-4/h23-24H,9-22H2,1-8H3.
What are the key properties of 1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one?
1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one has a molecular weight of 490.87 g/mol, XLogP of 7.24, 22 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,13-bis[diethoxy(methyl)silyl]-6,8-dimethyltridecan-7-one is sourced from PubChem (CID 87593225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).