About 4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one
4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one (PubChem CID 87593230) has the molecular formula C25H54O7Si2
and a molecular weight of 522.87 g/mol. Its IUPAC name is 4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one.
Molecular Properties
| Compound Name | 4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one |
| PubChem CID | 87593230 |
| Molecular Formula | C25H54O7Si2 |
| Molecular Weight | 522.87 g/mol |
| Exact Mass | 522.34 |
| IUPAC Name | 4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one |
| SMILES | CCO[Si](CCCC(CC)C(=O)C(CC)CCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C25H54O7Si2/c1-9-23(19-17-21-33(27-11-3,28-12-4)29-13-5)25(26)24(10-2)20-18-22-34(30-14-6,31-15-7)32-16-8/h23-24H,9-22H2,1-8H3 |
| InChIKey | AQKWIIKUPQFHRH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.87 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one?
The IUPAC name of 4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one (CID 87593230) is 4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one.
What is the SMILES notation for 4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one?
The canonical SMILES for 4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one is CCO[Si](CCCC(CC)C(=O)C(CC)CCC[Si](OCC)(OCC)OCC)(OCC)OCC.
What is the InChIKey of 4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one?
The InChIKey is AQKWIIKUPQFHRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H54O7Si2/c1-9-23(19-17-21-33(27-11-3,28-12-4)29-13-5)25(26)24(10-2)20-18-22-34(30-14-6,31-15-7)32-16-8/h23-24H,9-22H2,1-8H3.
What are the key properties of 4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one?
4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one has a molecular weight of 522.87 g/mol, XLogP of 6.27, 24 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diethyl-1,9-bis(triethoxysilyl)nonan-5-one is sourced from PubChem (CID 87593230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).