About 3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one
3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one (PubChem CID 87593603) has the molecular formula C21H46O7Si2
and a molecular weight of 466.76 g/mol. Its IUPAC name is 3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one |
| PubChem CID | 87593603 |
| Molecular Formula | C21H46O7Si2 |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one |
| SMILES | CCO[Si](CCC(C)C(=O)C(C)CC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C21H46O7Si2/c1-9-23-29(24-10-2,25-11-3)17-15-19(7)21(22)20(8)16-18-30(26-12-4,27-13-5)28-14-6/h19-20H,9-18H2,1-8H3 |
| InChIKey | GZBVCKXFGSGYBC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one?
The IUPAC name of 3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one (CID 87593603) is 3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one.
What is the SMILES notation for 3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one?
The canonical SMILES for 3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one is CCO[Si](CCC(C)C(=O)C(C)CC[Si](OCC)(OCC)OCC)(OCC)OCC.
What is the InChIKey of 3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one?
The InChIKey is GZBVCKXFGSGYBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H46O7Si2/c1-9-23-29(24-10-2,25-11-3)17-15-19(7)21(22)20(8)16-18-30(26-12-4,27-13-5)28-14-6/h19-20H,9-18H2,1-8H3.
What are the key properties of 3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one?
3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one has a molecular weight of 466.76 g/mol, XLogP of 4.70, 20 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,7-bis(triethoxysilyl)heptan-4-one is sourced from PubChem (CID 87593603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).