About 7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one
7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one (PubChem CID 87593608) has the molecular formula C31H66O7Si2
and a molecular weight of 607.03 g/mol. Its IUPAC name is 7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one.
Molecular Properties
| Compound Name | 7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one |
| PubChem CID | 87593608 |
| Molecular Formula | C31H66O7Si2 |
| Molecular Weight | 607.03 g/mol |
| Exact Mass | 606.43 |
| IUPAC Name | 7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one |
| SMILES | CCCCCCC(CC)(C(=O)C(CC)(CCCCCC)[Si](OCC)(OCC)OCC)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C31H66O7Si2/c1-11-21-23-25-27-30(13-3,39(33-15-5,34-16-6)35-17-7)29(32)31(14-4,28-26-24-22-12-2)40(36-18-8,37-19-9)38-20-10/h11-28H2,1-10H3 |
| InChIKey | NTYYPEBGJGXMPS-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 607.03 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one?
The IUPAC name of 7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one (CID 87593608) is 7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one.
What is the SMILES notation for 7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one?
The canonical SMILES for 7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one is CCCCCCC(CC)(C(=O)C(CC)(CCCCCC)[Si](OCC)(OCC)OCC)[Si](OCC)(OCC)OCC.
What is the InChIKey of 7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one?
The InChIKey is NTYYPEBGJGXMPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H66O7Si2/c1-11-21-23-25-27-30(13-3,39(33-15-5,34-16-6)35-17-7)29(32)31(14-4,28-26-24-22-12-2)40(36-18-8,37-19-9)38-20-10/h11-28H2,1-10H3.
What are the key properties of 7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one?
7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one has a molecular weight of 607.03 g/mol, XLogP of 8.89, 28 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-diethyl-7,9-bis(triethoxysilyl)pentadecan-8-one is sourced from PubChem (CID 87593608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).