About 3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium
3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium (PubChem CID 87593765) has the molecular formula C11H11ClF2NOTi-
and a molecular weight of 294.53 g/mol. Its IUPAC name is 3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium.
Molecular Properties
| Compound Name | 3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium |
| PubChem CID | 87593765 |
| Molecular Formula | C11H11ClF2NOTi- |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium |
| SMILES | CC(C)(CCl)C(=O)Nc1ccc(F)[c-]c1F.[Ti] |
| InChI | InChI=1S/C11H11ClF2NO.Ti/c1-11(2,6-12)10(16)15-9-4-3-7(13)5-8(9)14;/h3-4H,6H2,1-2H3,(H,15,16);/q-1; |
| InChIKey | VFBFOIJWEGGDDA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium?
The IUPAC name of 3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium (CID 87593765) is 3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium.
What is the SMILES notation for 3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium?
The canonical SMILES for 3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium is CC(C)(CCl)C(=O)Nc1ccc(F)[c-]c1F.[Ti].
What is the InChIKey of 3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium?
The InChIKey is VFBFOIJWEGGDDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF2NO.Ti/c1-11(2,6-12)10(16)15-9-4-3-7(13)5-8(9)14;/h3-4H,6H2,1-2H3,(H,15,16);/q-1;.
What are the key properties of 3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium?
3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium has a molecular weight of 294.53 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium is sourced from PubChem (CID 87593765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).