C27H58O5Si2 — CID 87593778
7,9-bis[diethoxy(ethyl)silyl]pentadecan-8-one (PubChem CID 87593778) has the molecular formula C27H58O5Si2 and a molecular weight of 518.93 g/mol. Its IUPAC name is 7,9-bis[diethoxy(ethyl)silyl]pentadecan-8-one.
| Compound Name | 7,9-bis[diethoxy(ethyl)silyl]pentadecan-8-one |
|---|---|
| PubChem CID | 87593778 |
| Molecular Formula | C27H58O5Si2 |
| Molecular Weight | 518.93 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | 7,9-bis[diethoxy(ethyl)silyl]pentadecan-8-one |
| SMILES | CCCCCCC(C(=O)C(CCCCCC)[Si](CC)(OCC)OCC)[Si](CC)(OCC)OCC |
| InChI | InChI=1S/C27H58O5Si2/c1-9-17-19-21-23-25(33(15-7,29-11-3)30-12-4)27(28)26(24-22-20-18-10-2)34(16-8,31-13-5)32-14-6/h25-26H,9-24H2,1-8H3 |
| InChIKey | GAXRUSIOTIJNGL-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.93 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|