About 1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one
1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one (PubChem CID 87593945) has the molecular formula C21H46O5Si2
and a molecular weight of 434.77 g/mol. Its IUPAC name is 1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one.
Molecular Properties
| Compound Name | 1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one |
| PubChem CID | 87593945 |
| Molecular Formula | C21H46O5Si2 |
| Molecular Weight | 434.77 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one |
| SMILES | CCO[Si](C)(CCC(CC)C(=O)C(CC)CC[Si](C)(OCC)OCC)OCC |
| InChI | InChI=1S/C21H46O5Si2/c1-9-19(15-17-27(7,23-11-3)24-12-4)21(22)20(10-2)16-18-28(8,25-13-5)26-14-6/h19-20H,9-18H2,1-8H3 |
| InChIKey | NICKHSUSZVFHAW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.77 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one?
The IUPAC name of 1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one (CID 87593945) is 1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one.
What is the SMILES notation for 1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one?
The canonical SMILES for 1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one is CCO[Si](C)(CCC(CC)C(=O)C(CC)CC[Si](C)(OCC)OCC)OCC.
What is the InChIKey of 1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one?
The InChIKey is NICKHSUSZVFHAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H46O5Si2/c1-9-19(15-17-27(7,23-11-3)24-12-4)21(22)20(10-2)16-18-28(8,25-13-5)26-14-6/h19-20H,9-18H2,1-8H3.
What are the key properties of 1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one?
1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one has a molecular weight of 434.77 g/mol, XLogP of 5.68, 18 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-bis[diethoxy(methyl)silyl]-3,5-diethylheptan-4-one is sourced from PubChem (CID 87593945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).