About 3-iodoaniline;triphenylphosphane
3-iodoaniline;triphenylphosphane (PubChem CID 87594319) has the molecular formula C24H21INP
and a molecular weight of 481.32 g/mol. Its IUPAC name is 3-iodoaniline;triphenylphosphane.
Molecular Properties
| Compound Name | 3-iodoaniline;triphenylphosphane |
| PubChem CID | 87594319 |
| Molecular Formula | C24H21INP |
| Molecular Weight | 481.32 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | 3-iodoaniline;triphenylphosphane |
| SMILES | Nc1cccc(I)c1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C6H6IN/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;7-5-2-1-3-6(8)4-5/h1-15H;1-4H,8H2 |
| InChIKey | ZKVLVUPAAWJJTI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.32 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-iodoaniline;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodoaniline;triphenylphosphane?
The IUPAC name of 3-iodoaniline;triphenylphosphane (CID 87594319) is 3-iodoaniline;triphenylphosphane.
What is the SMILES notation for 3-iodoaniline;triphenylphosphane?
The canonical SMILES for 3-iodoaniline;triphenylphosphane is Nc1cccc(I)c1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 3-iodoaniline;triphenylphosphane?
The InChIKey is ZKVLVUPAAWJJTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C6H6IN/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;7-5-2-1-3-6(8)4-5/h1-15H;1-4H,8H2.
What are the key properties of 3-iodoaniline;triphenylphosphane?
3-iodoaniline;triphenylphosphane has a molecular weight of 481.32 g/mol, XLogP of 5.32, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodoaniline;triphenylphosphane is sourced from PubChem (CID 87594319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).