About 1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine
1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine (PubChem CID 87594581) has the molecular formula C21H44N2
and a molecular weight of 324.60 g/mol. Its IUPAC name is 1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine |
| PubChem CID | 87594581 |
| Molecular Formula | C21H44N2 |
| Molecular Weight | 324.60 g/mol |
| Exact Mass | 324.35 |
| IUPAC Name | 1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNCC(C)N |
| InChI | InChI=1S/C21H44N2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-20-21(2)22/h10-11,21,23H,3-9,12-20,22H2,1-2H3/b11-10- |
| InChIKey | YVLLFYIFMKAGCT-KHPPLWFESA-N |
| XLogP | 5.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine?
The IUPAC name of 1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine (CID 87594581) is 1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine.
What is the SMILES notation for 1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine?
The canonical SMILES for 1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine is CCCCCCCC/C=C\CCCCCCCCNCC(C)N.
What is the InChIKey of 1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine?
The InChIKey is YVLLFYIFMKAGCT-KHPPLWFESA-N. The full InChI is InChI=1S/C21H44N2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-20-21(2)22/h10-11,21,23H,3-9,12-20,22H2,1-2H3/b11-10-.
What are the key properties of 1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine?
1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine has a molecular weight of 324.60 g/mol, XLogP of 5.96, 18 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[(Z)-octadec-9-enyl]propane-1,2-diamine is sourced from PubChem (CID 87594581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).