About icosan-2-one;propane-1,2,3-triol
icosan-2-one;propane-1,2,3-triol (PubChem CID 87594620) has the molecular formula C23H48O4
and a molecular weight of 388.63 g/mol. Its IUPAC name is icosan-2-one;propane-1,2,3-triol.
Molecular Properties
| Compound Name | icosan-2-one;propane-1,2,3-triol |
| PubChem CID | 87594620 |
| Molecular Formula | C23H48O4 |
| Molecular Weight | 388.63 g/mol |
| Exact Mass | 388.36 |
| IUPAC Name | icosan-2-one;propane-1,2,3-triol |
| SMILES | CCCCCCCCCCCCCCCCCCC(C)=O.OCC(O)CO |
| InChI | InChI=1S/C20H40O.C3H8O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)21;4-1-3(6)2-5/h3-19H2,1-2H3;3-6H,1-2H2 |
| InChIKey | YXKIJLJMUJEXSB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze icosan-2-one;propane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of icosan-2-one;propane-1,2,3-triol?
The IUPAC name of icosan-2-one;propane-1,2,3-triol (CID 87594620) is icosan-2-one;propane-1,2,3-triol.
What is the SMILES notation for icosan-2-one;propane-1,2,3-triol?
The canonical SMILES for icosan-2-one;propane-1,2,3-triol is CCCCCCCCCCCCCCCCCCC(C)=O.OCC(O)CO.
What is the InChIKey of icosan-2-one;propane-1,2,3-triol?
The InChIKey is YXKIJLJMUJEXSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O.C3H8O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)21;4-1-3(6)2-5/h3-19H2,1-2H3;3-6H,1-2H2.
What are the key properties of icosan-2-one;propane-1,2,3-triol?
icosan-2-one;propane-1,2,3-triol has a molecular weight of 388.63 g/mol, XLogP of 5.56, 19 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for icosan-2-one;propane-1,2,3-triol is sourced from PubChem (CID 87594620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).