About 3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride
3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride (PubChem CID 87594622) has the molecular formula C10H22ClN3
and a molecular weight of 219.76 g/mol. Its IUPAC name is 3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride |
| PubChem CID | 87594622 |
| Molecular Formula | C10H22ClN3 |
| Molecular Weight | 219.76 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride |
| SMILES | CCC(C)N=C=NCCCN(C)C.Cl |
| InChI | InChI=1S/C10H21N3.ClH/c1-5-10(2)12-9-11-7-6-8-13(3)4;/h10H,5-8H2,1-4H3;1H |
| InChIKey | AWBFGXUURYPYFW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.76 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride?
The IUPAC name of 3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride (CID 87594622) is 3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride.
What is the SMILES notation for 3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride?
The canonical SMILES for 3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride is CCC(C)N=C=NCCCN(C)C.Cl.
What is the InChIKey of 3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride?
The InChIKey is AWBFGXUURYPYFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3.ClH/c1-5-10(2)12-9-11-7-6-8-13(3)4;/h10H,5-8H2,1-4H3;1H.
What are the key properties of 3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride?
3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride has a molecular weight of 219.76 g/mol, XLogP of 2.33, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(butan-2-yliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride is sourced from PubChem (CID 87594622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).