C14H30O4 — CID 87594650
2-[2-[2-(3-methylbutoxy)propoxy]propoxy]propan-1-ol (PubChem CID 87594650) has the molecular formula C14H30O4 and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-[2-[2-(3-methylbutoxy)propoxy]propoxy]propan-1-ol.
| Compound Name | 2-[2-[2-(3-methylbutoxy)propoxy]propoxy]propan-1-ol |
|---|---|
| PubChem CID | 87594650 |
| Molecular Formula | C14H30O4 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 2-[2-[2-(3-methylbutoxy)propoxy]propoxy]propan-1-ol |
| SMILES | CC(C)CCOC(C)COC(C)COC(C)CO |
| InChI | InChI=1S/C14H30O4/c1-11(2)6-7-16-13(4)9-18-14(5)10-17-12(3)8-15/h11-15H,6-10H2,1-5H3 |
| InChIKey | LQPRGDBTQROLLJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |