About pyrano[2,3-f]chromene-2,5-dione
pyrano[2,3-f]chromene-2,5-dione (PubChem CID 87595023) has the molecular formula C12H6O4
and a molecular weight of 214.18 g/mol. Its IUPAC name is pyrano[2,3-f]chromene-2,5-dione.
Molecular Properties
| Compound Name | pyrano[2,3-f]chromene-2,5-dione |
| PubChem CID | 87595023 |
| Molecular Formula | C12H6O4 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | pyrano[2,3-f]chromene-2,5-dione |
| SMILES | O=c1ccc2c(=O)cc3occcc-3c2o1 |
| InChI | InChI=1S/C12H6O4/c13-9-6-10-8(2-1-5-15-10)12-7(9)3-4-11(14)16-12/h1-6H |
| InChIKey | XEPDKURZMUAWHZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrano[2,3-f]chromene-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrano[2,3-f]chromene-2,5-dione?
The IUPAC name of pyrano[2,3-f]chromene-2,5-dione (CID 87595023) is pyrano[2,3-f]chromene-2,5-dione.
What is the SMILES notation for pyrano[2,3-f]chromene-2,5-dione?
The canonical SMILES for pyrano[2,3-f]chromene-2,5-dione is O=c1ccc2c(=O)cc3occcc-3c2o1.
What is the InChIKey of pyrano[2,3-f]chromene-2,5-dione?
The InChIKey is XEPDKURZMUAWHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6O4/c13-9-6-10-8(2-1-5-15-10)12-7(9)3-4-11(14)16-12/h1-6H.
What are the key properties of pyrano[2,3-f]chromene-2,5-dione?
pyrano[2,3-f]chromene-2,5-dione has a molecular weight of 214.18 g/mol, XLogP of 1.85, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrano[2,3-f]chromene-2,5-dione is sourced from PubChem (CID 87595023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).