C10H23NO2 — CID 87595068
1,2-dimethoxy-N,N,4-trimethylpentan-1-amine (PubChem CID 87595068) has the molecular formula C10H23NO2 and a molecular weight of 189.30 g/mol. Its IUPAC name is 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine.
| Compound Name | 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 87595068 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine |
| SMILES | COC(CC(C)C)C(OC)N(C)C |
| InChI | InChI=1S/C10H23NO2/c1-8(2)7-9(12-5)10(13-6)11(3)4/h8-10H,7H2,1-6H3 |
| InChIKey | XWDKZHJVZMBBNB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|