About 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine
1,2-dimethoxy-N,N,4-trimethylpentan-1-amine (PubChem CID 87595068) has the molecular formula C10H23NO2
and a molecular weight of 189.30 g/mol. Its IUPAC name is 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine.
Molecular Properties
| Compound Name | 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine |
| PubChem CID | 87595068 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine |
| SMILES | COC(CC(C)C)C(OC)N(C)C |
| InChI | InChI=1S/C10H23NO2/c1-8(2)7-9(12-5)10(13-6)11(3)4/h8-10H,7H2,1-6H3 |
| InChIKey | XWDKZHJVZMBBNB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine?
The IUPAC name of 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine (CID 87595068) is 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine.
What is the SMILES notation for 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine?
The canonical SMILES for 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine is COC(CC(C)C)C(OC)N(C)C.
What is the InChIKey of 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine?
The InChIKey is XWDKZHJVZMBBNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO2/c1-8(2)7-9(12-5)10(13-6)11(3)4/h8-10H,7H2,1-6H3.
What are the key properties of 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine?
1,2-dimethoxy-N,N,4-trimethylpentan-1-amine has a molecular weight of 189.30 g/mol, XLogP of 1.58, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethoxy-N,N,4-trimethylpentan-1-amine is sourced from PubChem (CID 87595068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).