C14H23N3O2S — CID 87595084
3-oxo-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid (PubChem CID 87595084) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 3-oxo-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid.
| Compound Name | 3-oxo-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid |
|---|---|
| PubChem CID | 87595084 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-oxo-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid |
| SMILES | C=CCN1C(=O)C(C(C)C)NC12CCN(C(=O)S)CC2 |
| InChI | InChI=1S/C14H23N3O2S/c1-4-7-17-12(18)11(10(2)3)15-14(17)5-8-16(9-6-14)13(19)20/h4,10-11,15H,1,5-9H2,2-3H3,(H,19,20) |
| InChIKey | JTTGBIHBHPHBPM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|