About Methyl-seleno-l-cysteine
Methyl-seleno-l-cysteine (PubChem CID 87595123) has the molecular formula C4H8NOSSe
and a molecular weight of 197.14 g/mol.
Molecular Properties
| Compound Name | Methyl-seleno-l-cysteine |
| PubChem CID | 87595123 |
| Molecular Formula | C4H8NOSSe |
| Molecular Weight | 197.14 g/mol |
| Exact Mass | 197.95 |
| IUPAC Name | — |
| SMILES | CN[C@@H](CS)C(=O)[Se] |
| InChI | InChI=1S/C4H8NOSSe/c1-5-3(2-7)4(6)8/h3,5,7H,2H2,1H3/t3-/m0/s1 |
| InChIKey | YSHOUBPYOHRCKR-VKHMYHEASA-N |
| XLogP | -0.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.14 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze Methyl-seleno-l-cysteine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Methyl-seleno-l-cysteine?
The IUPAC name of Methyl-seleno-l-cysteine (CID 87595123) is not available.
What is the SMILES notation for Methyl-seleno-l-cysteine?
The canonical SMILES for Methyl-seleno-l-cysteine is CN[C@@H](CS)C(=O)[Se].
What is the InChIKey of Methyl-seleno-l-cysteine?
The InChIKey is YSHOUBPYOHRCKR-VKHMYHEASA-N. The full InChI is InChI=1S/C4H8NOSSe/c1-5-3(2-7)4(6)8/h3,5,7H,2H2,1H3/t3-/m0/s1.
What are the key properties of Methyl-seleno-l-cysteine?
Methyl-seleno-l-cysteine has a molecular weight of 197.14 g/mol, XLogP of -0.80, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Methyl-seleno-l-cysteine is sourced from PubChem (CID 87595123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).