C22H25N3O2S — CID 87595185
2,4-dibenzyl-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid (PubChem CID 87595185) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 2,4-dibenzyl-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid.
| Compound Name | 2,4-dibenzyl-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid |
|---|---|
| PubChem CID | 87595185 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2,4-dibenzyl-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid |
| SMILES | O=C(S)N1CCC2(CC1)NC(Cc1ccccc1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C22H25N3O2S/c26-20-19(15-17-7-3-1-4-8-17)23-22(11-13-24(14-12-22)21(27)28)25(20)16-18-9-5-2-6-10-18/h1-10,19,23H,11-16H2,(H,27,28) |
| InChIKey | FCWUOBCSWLOFLQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|