About copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane)
copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane) (PubChem CID 87595607) has the molecular formula C16H36CuO4P2S4
and a molecular weight of 546.22 g/mol. Its IUPAC name is copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane).
Molecular Properties
| Compound Name | copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane) |
| PubChem CID | 87595607 |
| Molecular Formula | C16H36CuO4P2S4 |
| Molecular Weight | 546.22 g/mol |
| Exact Mass | 545.03 |
| IUPAC Name | copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane) |
| SMILES | CC(C)COP(=S)([S-])OCC(C)C.CC(C)COP(=S)([S-])OCC(C)C.[Cu+2] |
| InChI | InChI=1S/2C8H19O2PS2.Cu/c2*1-7(2)5-9-11(12,13)10-6-8(3)4;/h2*7-8H,5-6H2,1-4H3,(H,12,13);/q;;+2/p-2 |
| InChIKey | YPBWLSXBHDGNRB-UHFFFAOYSA-L |
| XLogP | 6.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.22 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane)?
The IUPAC name of copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane) (CID 87595607) is copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane).
What is the SMILES notation for copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane)?
The canonical SMILES for copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane) is CC(C)COP(=S)([S-])OCC(C)C.CC(C)COP(=S)([S-])OCC(C)C.[Cu+2].
What is the InChIKey of copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane)?
The InChIKey is YPBWLSXBHDGNRB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H19O2PS2.Cu/c2*1-7(2)5-9-11(12,13)10-6-8(3)4;/h2*7-8H,5-6H2,1-4H3,(H,12,13);/q;;+2/p-2.
What are the key properties of copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane)?
copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane) has a molecular weight of 546.22 g/mol, XLogP of 6.20, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(bis(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane) is sourced from PubChem (CID 87595607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).