C8H12N2O — CID 87596541
2-(3,4-dimethyl-2-oxopyrrolidin-1-yl)acetonitrile (PubChem CID 87596541) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-(3,4-dimethyl-2-oxopyrrolidin-1-yl)acetonitrile.
| Compound Name | 2-(3,4-dimethyl-2-oxopyrrolidin-1-yl)acetonitrile |
|---|---|
| PubChem CID | 87596541 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2-(3,4-dimethyl-2-oxopyrrolidin-1-yl)acetonitrile |
| SMILES | CC1CN(CC#N)C(=O)C1C |
| InChI | InChI=1S/C8H12N2O/c1-6-5-10(4-3-9)8(11)7(6)2/h6-7H,4-5H2,1-2H3 |
| InChIKey | VVOWJSRTITVKSD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|