C24H32F5N5O5S2 — CID 87597023
N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]-N,3-dimethyl-1H-imidazol-3-ium-2-sulfonamide;trifluoromethanesulfonate (PubChem CID 87597023) has the molecular formula C24H32F5N5O5S2 and a molecular weight of 629.67 g/mol. Its IUPAC name is N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]-N,3-dimethyl-1H-imidazol-3-ium-2-sulfonamide;trifluoromethanesulfonate.
| Compound Name | N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]-N,3-dimethyl-1H-imidazol-3-ium-2-sulfonamide;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87597023 |
| Molecular Formula | C24H32F5N5O5S2 |
| Molecular Weight | 629.67 g/mol |
| Exact Mass | 629.18 |
| IUPAC Name | N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]-N,3-dimethyl-1H-imidazol-3-ium-2-sulfonamide;trifluoromethanesulfonate |
| SMILES | CN(c1ccc2c(c1)nc(C(C)(C)C)n2CC1CCC(F)(F)CC1)S(=O)(=O)c1[nH]cc[n+]1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C23H31F2N5O2S.CHF3O3S/c1-22(2,3)20-27-18-14-17(29(5)33(31,32)21-26-12-13-28(21)4)6-7-19(18)30(20)15-16-8-10-23(24,25)11-9-16;2-1(3,4)8(5,6)7/h6-7,12-14,16H,8-11,15H2,1-5H3;(H,5,6,7) |
| InChIKey | GODCICQYNBOSRE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 132.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.67 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|