C22H18ClN5O2S — CID 87597530
6-[(2-chloro-3-pyridinyl)sulfonyl]-N-quinolin-3-yl-7,8-dihydro-5H-2,6-naphthyridin-1-amine (PubChem CID 87597530) has the molecular formula C22H18ClN5O2S and a molecular weight of 451.94 g/mol. Its IUPAC name is 6-[(2-chloro-3-pyridinyl)sulfonyl]-N-quinolin-3-yl-7,8-dihydro-5H-2,6-naphthyridin-1-amine.
| Compound Name | 6-[(2-chloro-3-pyridinyl)sulfonyl]-N-quinolin-3-yl-7,8-dihydro-5H-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 87597530 |
| Molecular Formula | C22H18ClN5O2S |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 6-[(2-chloro-3-pyridinyl)sulfonyl]-N-quinolin-3-yl-7,8-dihydro-5H-2,6-naphthyridin-1-amine |
| SMILES | O=S(=O)(c1cccnc1Cl)N1CCc2c(ccnc2Nc2cnc3ccccc3c2)C1 |
| InChI | InChI=1S/C22H18ClN5O2S/c23-21-20(6-3-9-24-21)31(29,30)28-11-8-18-16(14-28)7-10-25-22(18)27-17-12-15-4-1-2-5-19(15)26-13-17/h1-7,9-10,12-13H,8,11,14H2,(H,25,27) |
| InChIKey | SPNBQYCTALXIBL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|