C23H22F5N3O4 — CID 87597616
(2R)-2-hydroxy-N'-[(7S)-6-oxo-5,7-dihydrobenzo[d][1]benzazepin-7-yl]-N'-(2,2,3,3,3-pentafluoropropyl)-2-propylpropanediamide (PubChem CID 87597616) has the molecular formula C23H22F5N3O4 and a molecular weight of 499.44 g/mol. Its IUPAC name is (2R)-2-hydroxy-N'-[(7S)-6-oxo-5,7-dihydrobenzo[d][1]benzazepin-7-yl]-N'-(2,2,3,3,3-pentafluoropropyl)-2-propylpropanediamide.
| Compound Name | (2R)-2-hydroxy-N'-[(7S)-6-oxo-5,7-dihydrobenzo[d][1]benzazepin-7-yl]-N'-(2,2,3,3,3-pentafluoropropyl)-2-propylpropanediamide |
|---|---|
| PubChem CID | 87597616 |
| Molecular Formula | C23H22F5N3O4 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | (2R)-2-hydroxy-N'-[(7S)-6-oxo-5,7-dihydrobenzo[d][1]benzazepin-7-yl]-N'-(2,2,3,3,3-pentafluoropropyl)-2-propylpropanediamide |
| SMILES | CCC[C@@](O)(C(N)=O)C(=O)N(CC(F)(F)C(F)(F)F)[C@@H]1C(=O)Nc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H22F5N3O4/c1-2-11-21(35,19(29)33)20(34)31(12-22(24,25)23(26,27)28)17-15-9-4-3-7-13(15)14-8-5-6-10-16(14)30-18(17)32/h3-10,17,35H,2,11-12H2,1H3,(H2,29,33)(H,30,32)/t17-,21+/m0/s1 |
| InChIKey | JLYLQGXQLXZKRQ-LAUBAEHRSA-N |
| XLogP | 3.39 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|