C14H8N4O2S — CID 87598175
4-(7-cyano-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidin-6-yl)benzoic acid (PubChem CID 87598175) has the molecular formula C14H8N4O2S and a molecular weight of 296.31 g/mol. Its IUPAC name is 4-(7-cyano-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidin-6-yl)benzoic acid.
| Compound Name | 4-(7-cyano-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidin-6-yl)benzoic acid |
|---|---|
| PubChem CID | 87598175 |
| Molecular Formula | C14H8N4O2S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 4-(7-cyano-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidin-6-yl)benzoic acid |
| SMILES | N#Cc1c(-c2ccc(C(=O)O)cc2)[nH]c2c(=S)nc[nH]c12 |
| InChI | InChI=1S/C14H8N4O2S/c15-5-9-10(7-1-3-8(4-2-7)14(19)20)18-12-11(9)16-6-17-13(12)21/h1-4,6,18H,(H,19,20)(H,16,17,21) |
| InChIKey | VKBWLEMVXBBTAA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|