About N'-ethoxy-N'-propoxyethane-1,2-diamine
N'-ethoxy-N'-propoxyethane-1,2-diamine (PubChem CID 87598750) has the molecular formula C7H18N2O2
and a molecular weight of 162.23 g/mol. Its IUPAC name is N'-ethoxy-N'-propoxyethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-ethoxy-N'-propoxyethane-1,2-diamine |
| PubChem CID | 87598750 |
| Molecular Formula | C7H18N2O2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | N'-ethoxy-N'-propoxyethane-1,2-diamine |
| SMILES | CCCON(CCN)OCC |
| InChI | InChI=1S/C7H18N2O2/c1-3-7-11-9(6-5-8)10-4-2/h3-8H2,1-2H3 |
| InChIKey | FOSAAYGIPKXTPY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethoxy-N'-propoxyethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethoxy-N'-propoxyethane-1,2-diamine?
The IUPAC name of N'-ethoxy-N'-propoxyethane-1,2-diamine (CID 87598750) is N'-ethoxy-N'-propoxyethane-1,2-diamine.
What is the SMILES notation for N'-ethoxy-N'-propoxyethane-1,2-diamine?
The canonical SMILES for N'-ethoxy-N'-propoxyethane-1,2-diamine is CCCON(CCN)OCC.
What is the InChIKey of N'-ethoxy-N'-propoxyethane-1,2-diamine?
The InChIKey is FOSAAYGIPKXTPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2O2/c1-3-7-11-9(6-5-8)10-4-2/h3-8H2,1-2H3.
What are the key properties of N'-ethoxy-N'-propoxyethane-1,2-diamine?
N'-ethoxy-N'-propoxyethane-1,2-diamine has a molecular weight of 162.23 g/mol, XLogP of 0.54, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethoxy-N'-propoxyethane-1,2-diamine is sourced from PubChem (CID 87598750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).