C19H16F3NO2 — CID 87598810
(2E,4Z)-5-[3-(hydroxymethyl)phenyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 87598810) has the molecular formula C19H16F3NO2 and a molecular weight of 347.34 g/mol. Its IUPAC name is (2E,4Z)-5-[3-(hydroxymethyl)phenyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4Z)-5-[3-(hydroxymethyl)phenyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 87598810 |
| Molecular Formula | C19H16F3NO2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | (2E,4Z)-5-[3-(hydroxymethyl)phenyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | NC(=O)/C=C/C=C(/c1ccc(C(F)(F)F)cc1)c1cccc(CO)c1 |
| InChI | InChI=1S/C19H16F3NO2/c20-19(21,22)16-9-7-14(8-10-16)17(5-2-6-18(23)25)15-4-1-3-13(11-15)12-24/h1-11,24H,12H2,(H2,23,25)/b6-2+,17-5- |
| InChIKey | DASWDFCIDCUOLP-AKOZPELHSA-N |
| XLogP | 3.67 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|