C9H4F11NO3 — CID 87599158
[1,1,2,2-tetrafluoro-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl] prop-2-enoate (PubChem CID 87599158) has the molecular formula C9H4F11NO3 and a molecular weight of 383.11 g/mol. Its IUPAC name is [1,1,2,2-tetrafluoro-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl] prop-2-enoate.
| Compound Name | [1,1,2,2-tetrafluoro-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 87599158 |
| Molecular Formula | C9H4F11NO3 |
| Molecular Weight | 383.11 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | [1,1,2,2-tetrafluoro-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(F)(F)C(F)(F)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H4F11NO3/c1-2-3(22)24-9(19,20)8(17,18)21-4(23)5(10,11)6(12,13)7(14,15)16/h2H,1H2,(H,21,23) |
| InChIKey | CCOMUIHLHKJPCH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.11 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|