About 1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine
1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine (PubChem CID 87599572) has the molecular formula C4H2F10N2
and a molecular weight of 268.05 g/mol. Its IUPAC name is 1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine.
Molecular Properties
| Compound Name | 1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine |
| PubChem CID | 87599572 |
| Molecular Formula | C4H2F10N2 |
| Molecular Weight | 268.05 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine |
| SMILES | FC(F)N(N(C(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H2F10N2/c5-1(6)15(3(9,10)11)16(2(7)8)4(12,13)14/h1-2H |
| InChIKey | NBZOMUYJKGZQOS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.05 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine?
The IUPAC name of 1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine (CID 87599572) is 1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine.
What is the SMILES notation for 1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine?
The canonical SMILES for 1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine is FC(F)N(N(C(F)F)C(F)(F)F)C(F)(F)F.
What is the InChIKey of 1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine?
The InChIKey is NBZOMUYJKGZQOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2F10N2/c5-1(6)15(3(9,10)11)16(2(7)8)4(12,13)14/h1-2H.
What are the key properties of 1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine?
1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine has a molecular weight of 268.05 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(difluoromethyl)-1,2-bis(trifluoromethyl)hydrazine is sourced from PubChem (CID 87599572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).