About 6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile
6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile (PubChem CID 87599667) has the molecular formula C13H8N4OS
and a molecular weight of 268.30 g/mol. Its IUPAC name is 6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile.
Molecular Properties
| Compound Name | 6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile |
| PubChem CID | 87599667 |
| Molecular Formula | C13H8N4OS |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile |
| SMILES | N#Cc1c(-c2cccc(O)c2)[nH]c2c(=S)nc[nH]c12 |
| InChI | InChI=1S/C13H8N4OS/c14-5-9-10(7-2-1-3-8(18)4-7)17-12-11(9)15-6-16-13(12)19/h1-4,6,17-18H,(H,15,16,19) |
| InChIKey | GGUCKHCFZTWHDK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile?
The IUPAC name of 6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile (CID 87599667) is 6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile.
What is the SMILES notation for 6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile?
The canonical SMILES for 6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile is N#Cc1c(-c2cccc(O)c2)[nH]c2c(=S)nc[nH]c12.
What is the InChIKey of 6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile?
The InChIKey is GGUCKHCFZTWHDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N4OS/c14-5-9-10(7-2-1-3-8(18)4-7)17-12-11(9)15-6-16-13(12)19/h1-4,6,17-18H,(H,15,16,19).
What are the key properties of 6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile?
6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile has a molecular weight of 268.30 g/mol, XLogP of 2.86, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-hydroxyphenyl)-4-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidine-7-carbonitrile is sourced from PubChem (CID 87599667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).