About (2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid
(2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid (PubChem CID 87599877) has the molecular formula C21H44O4Si2
and a molecular weight of 416.75 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid.
Molecular Properties
| Compound Name | (2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid |
| PubChem CID | 87599877 |
| Molecular Formula | C21H44O4Si2 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | (2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid |
| SMILES | C=CC[C@@](C)(C(=O)O)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O4Si2/c1-13-15-21(8,18(22)23)17(25-27(11,12)20(5,6)7)14-16-24-26(9,10)19(2,3)4/h13,17H,1,14-16H2,2-12H3,(H,22,23)/t17-,21+/m0/s1 |
| InChIKey | OTISPOQHQOEHMM-LAUBAEHRSA-N |
| XLogP | 6.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid?
The IUPAC name of (2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid (CID 87599877) is (2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid.
What is the SMILES notation for (2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid?
The canonical SMILES for (2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid is C=CC[C@@](C)(C(=O)O)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid?
The InChIKey is OTISPOQHQOEHMM-LAUBAEHRSA-N. The full InChI is InChI=1S/C21H44O4Si2/c1-13-15-21(8,18(22)23)17(25-27(11,12)20(5,6)7)14-16-24-26(9,10)19(2,3)4/h13,17H,1,14-16H2,2-12H3,(H,22,23)/t17-,21+/m0/s1.
What are the key properties of (2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid?
(2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid has a molecular weight of 416.75 g/mol, XLogP of 6.46, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methylpent-4-enoic acid is sourced from PubChem (CID 87599877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).