C29H26F3N3O4 — CID 87600137
(2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(6-propoxy-3-pyridinyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 87600137) has the molecular formula C29H26F3N3O4 and a molecular weight of 537.54 g/mol. Its IUPAC name is (2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(6-propoxy-3-pyridinyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(6-propoxy-3-pyridinyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 87600137 |
| Molecular Formula | C29H26F3N3O4 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | (2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(6-propoxy-3-pyridinyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | CCCOc1ccc(/C(=C\C=C\C(=O)Nc2cccc3c2CC(O)C(=O)N3)c2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C29H26F3N3O4/c1-2-15-39-27-14-11-19(17-33-27)21(18-9-12-20(13-10-18)29(30,31)32)5-3-8-26(37)34-23-6-4-7-24-22(23)16-25(36)28(38)35-24/h3-14,17,25,36H,2,15-16H2,1H3,(H,34,37)(H,35,38)/b8-3+,21-5- |
| InChIKey | SHBRODNWIWIVQG-ADXQEJGJSA-N |
| XLogP | 5.37 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|