C22H21ClF2N2 — CID 87600349
2-chloro-7,8-difluoro-4-[(2-propan-2-yl-1,2,3,4-tetrahydroquinolin-3-yl)methyl]quinoline (PubChem CID 87600349) has the molecular formula C22H21ClF2N2 and a molecular weight of 386.87 g/mol. Its IUPAC name is 2-chloro-7,8-difluoro-4-[(2-propan-2-yl-1,2,3,4-tetrahydroquinolin-3-yl)methyl]quinoline.
| Compound Name | 2-chloro-7,8-difluoro-4-[(2-propan-2-yl-1,2,3,4-tetrahydroquinolin-3-yl)methyl]quinoline |
|---|---|
| PubChem CID | 87600349 |
| Molecular Formula | C22H21ClF2N2 |
| Molecular Weight | 386.87 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-chloro-7,8-difluoro-4-[(2-propan-2-yl-1,2,3,4-tetrahydroquinolin-3-yl)methyl]quinoline |
| SMILES | CC(C)C1Nc2ccccc2CC1Cc1cc(Cl)nc2c(F)c(F)ccc12 |
| InChI | InChI=1S/C22H21ClF2N2/c1-12(2)21-15(9-13-5-3-4-6-18(13)26-21)10-14-11-19(23)27-22-16(14)7-8-17(24)20(22)25/h3-8,11-12,15,21,26H,9-10H2,1-2H3 |
| InChIKey | YDEHVFJGGDWPEJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.87 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|