About 2,3-dihydro-1H-indeno[1,2-h]isoquinoline
2,3-dihydro-1H-indeno[1,2-h]isoquinoline (PubChem CID 87600709) has the molecular formula C16H13N
and a molecular weight of 219.29 g/mol. Its IUPAC name is 2,3-dihydro-1H-indeno[1,2-h]isoquinoline.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-indeno[1,2-h]isoquinoline |
| PubChem CID | 87600709 |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2,3-dihydro-1H-indeno[1,2-h]isoquinoline |
| SMILES | C1=c2ccc3c(c2CNC1)C=c1ccccc1=3 |
| InChI | InChI=1S/C16H13N/c1-2-4-13-12(3-1)9-15-14(13)6-5-11-7-8-17-10-16(11)15/h1-7,9,17H,8,10H2 |
| InChIKey | XDAIXAMIVQMQCR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dihydro-1H-indeno[1,2-h]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-indeno[1,2-h]isoquinoline?
The IUPAC name of 2,3-dihydro-1H-indeno[1,2-h]isoquinoline (CID 87600709) is 2,3-dihydro-1H-indeno[1,2-h]isoquinoline.
What is the SMILES notation for 2,3-dihydro-1H-indeno[1,2-h]isoquinoline?
The canonical SMILES for 2,3-dihydro-1H-indeno[1,2-h]isoquinoline is C1=c2ccc3c(c2CNC1)C=c1ccccc1=3.
What is the InChIKey of 2,3-dihydro-1H-indeno[1,2-h]isoquinoline?
The InChIKey is XDAIXAMIVQMQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N/c1-2-4-13-12(3-1)9-15-14(13)6-5-11-7-8-17-10-16(11)15/h1-7,9,17H,8,10H2.
What are the key properties of 2,3-dihydro-1H-indeno[1,2-h]isoquinoline?
2,3-dihydro-1H-indeno[1,2-h]isoquinoline has a molecular weight of 219.29 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indeno[1,2-h]isoquinoline is sourced from PubChem (CID 87600709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).