C5H4F9N — CID 87600740
3,3,3-trifluoro-N,N-bis(trifluoromethyl)propan-1-amine (PubChem CID 87600740) has the molecular formula C5H4F9N and a molecular weight of 249.08 g/mol. Its IUPAC name is 3,3,3-trifluoro-N,N-bis(trifluoromethyl)propan-1-amine.
| Compound Name | 3,3,3-trifluoro-N,N-bis(trifluoromethyl)propan-1-amine |
|---|---|
| PubChem CID | 87600740 |
| Molecular Formula | C5H4F9N |
| Molecular Weight | 249.08 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 3,3,3-trifluoro-N,N-bis(trifluoromethyl)propan-1-amine |
| SMILES | FC(F)(F)CCN(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H4F9N/c6-3(7,8)1-2-15(4(9,10)11)5(12,13)14/h1-2H2 |
| InChIKey | RWQWIZRXXYZXTM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.08 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|