4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid

C5H7F3O3 — CID 87600781

IUPAC4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid
SMILESCC(O)(CC(F)(F)F)C(=O)O
InChIInChI=1S/C5H7F3O3/c1-4(11,3(9)10)2-5(6,7)8/h11H,2H2,1H3,(H,9,10)
InChIKeyKTCYYOZQCRIAAF-UHFFFAOYSA-N
MW172.10 g/mol
LogP0.77
Rot. Bonds2

About 4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid

4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid (PubChem CID 87600781) has the molecular formula C5H7F3O3 and a molecular weight of 172.10 g/mol. Its IUPAC name is 4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid.

Molecular Properties

Compound Name4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid
PubChem CID87600781
Molecular FormulaC5H7F3O3
Molecular Weight172.10 g/mol
Exact Mass172.03
IUPAC Name4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid
SMILESCC(O)(CC(F)(F)F)C(=O)O
InChIInChI=1S/C5H7F3O3/c1-4(11,3(9)10)2-5(6,7)8/h11H,2H2,1H3,(H,9,10)
InChIKeyKTCYYOZQCRIAAF-UHFFFAOYSA-N
XLogP0.77
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.10
LogP ≤ 50.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid?
The IUPAC name of 4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid (CID 87600781) is 4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid.
What is the SMILES notation for 4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid?
The canonical SMILES for 4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid is CC(O)(CC(F)(F)F)C(=O)O.
What is the InChIKey of 4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid?
The InChIKey is KTCYYOZQCRIAAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F3O3/c1-4(11,3(9)10)2-5(6,7)8/h11H,2H2,1H3,(H,9,10).
What are the key properties of 4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid?
4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid has a molecular weight of 172.10 g/mol, XLogP of 0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,4-trifluoro-2-hydroxy-2-methylbutanoic acid is sourced from PubChem (CID 87600781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).