About (2E)-N-ethylnona-2,6-dienamide
(2E)-N-ethylnona-2,6-dienamide (PubChem CID 87600798) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is (2E)-N-ethylnona-2,6-dienamide.
Molecular Properties
| Compound Name | (2E)-N-ethylnona-2,6-dienamide |
| PubChem CID | 87600798 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2E)-N-ethylnona-2,6-dienamide |
| SMILES | CCC=CCC/C=C/C(=O)NCC |
| InChI | InChI=1S/C11H19NO/c1-3-5-6-7-8-9-10-11(13)12-4-2/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,12,13)/b6-5?,10-9+ |
| InChIKey | ARSJQOAYGVNWEK-ZFZICBQDSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-ethylnona-2,6-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-ethylnona-2,6-dienamide?
The IUPAC name of (2E)-N-ethylnona-2,6-dienamide (CID 87600798) is (2E)-N-ethylnona-2,6-dienamide.
What is the SMILES notation for (2E)-N-ethylnona-2,6-dienamide?
The canonical SMILES for (2E)-N-ethylnona-2,6-dienamide is CCC=CCC/C=C/C(=O)NCC.
What is the InChIKey of (2E)-N-ethylnona-2,6-dienamide?
The InChIKey is ARSJQOAYGVNWEK-ZFZICBQDSA-N. The full InChI is InChI=1S/C11H19NO/c1-3-5-6-7-8-9-10-11(13)12-4-2/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,12,13)/b6-5?,10-9+.
What are the key properties of (2E)-N-ethylnona-2,6-dienamide?
(2E)-N-ethylnona-2,6-dienamide has a molecular weight of 181.28 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-ethylnona-2,6-dienamide is sourced from PubChem (CID 87600798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).