C19H24N2O7S — CID 87601010
(2R,4S)-2-tert-butyl-2-[(1,3-dioxoisoindol-2-yl)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylic acid (PubChem CID 87601010) has the molecular formula C19H24N2O7S and a molecular weight of 424.48 g/mol. Its IUPAC name is (2R,4S)-2-tert-butyl-2-[(1,3-dioxoisoindol-2-yl)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylic acid.
| Compound Name | (2R,4S)-2-tert-butyl-2-[(1,3-dioxoisoindol-2-yl)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87601010 |
| Molecular Formula | C19H24N2O7S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (2R,4S)-2-tert-butyl-2-[(1,3-dioxoisoindol-2-yl)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylic acid |
| SMILES | CC(C)(C)[C@@]1(CN2C(=O)c3ccccc3C2=O)C[C@H](OS(C)(=O)=O)CN1C(=O)O |
| InChI | InChI=1S/C19H24N2O7S/c1-18(2,3)19(9-12(28-29(4,26)27)10-21(19)17(24)25)11-20-15(22)13-7-5-6-8-14(13)16(20)23/h5-8,12H,9-11H2,1-4H3,(H,24,25)/t12-,19-/m0/s1 |
| InChIKey | KGFQNKKYLZYRAS-BUXKBTBVSA-N |
| XLogP | 1.80 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|