C17H32O3 — CID 87601057
1,1-dimethoxyethane;(4E,8E)-5,9-dimethylundeca-4,8-dienal (PubChem CID 87601057) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is 1,1-dimethoxyethane;(4E,8E)-5,9-dimethylundeca-4,8-dienal.
| Compound Name | 1,1-dimethoxyethane;(4E,8E)-5,9-dimethylundeca-4,8-dienal |
|---|---|
| PubChem CID | 87601057 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 1,1-dimethoxyethane;(4E,8E)-5,9-dimethylundeca-4,8-dienal |
| SMILES | CC/C(C)=C/CC/C(C)=C/CCC=O.COC(C)OC |
| InChI | InChI=1S/C13H22O.C4H10O2/c1-4-12(2)9-7-10-13(3)8-5-6-11-14;1-4(5-2)6-3/h8-9,11H,4-7,10H2,1-3H3;4H,1-3H3/b12-9+,13-8+; |
| InChIKey | LMKAJZOOMYXXDU-IWXBLXEXSA-N |
| XLogP | 4.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|