About 8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione
8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione (PubChem CID 87601155) has the molecular formula C18H15NO5
and a molecular weight of 325.32 g/mol. Its IUPAC name is 8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione.
Molecular Properties
| Compound Name | 8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione |
| PubChem CID | 87601155 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione |
| SMILES | C=CCN(CC=C)c1ccc2c(c1)oc(=O)c1c(O)cc(=O)oc12 |
| InChI | InChI=1S/C18H15NO5/c1-3-7-19(8-4-2)11-5-6-12-14(9-11)23-18(22)16-13(20)10-15(21)24-17(12)16/h3-6,9-10,20H,1-2,7-8H2 |
| InChIKey | AIJPTPFAEVHYDL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione?
The IUPAC name of 8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione (CID 87601155) is 8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione.
What is the SMILES notation for 8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione?
The canonical SMILES for 8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione is C=CCN(CC=C)c1ccc2c(c1)oc(=O)c1c(O)cc(=O)oc12.
What is the InChIKey of 8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione?
The InChIKey is AIJPTPFAEVHYDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO5/c1-3-7-19(8-4-2)11-5-6-12-14(9-11)23-18(22)16-13(20)10-15(21)24-17(12)16/h3-6,9-10,20H,1-2,7-8H2.
What are the key properties of 8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione?
8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione has a molecular weight of 325.32 g/mol, XLogP of 2.78, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[bis(prop-2-enyl)amino]-4-hydroxypyrano[3,2-c]chromene-2,5-dione is sourced from PubChem (CID 87601155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).