About N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide
N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide (PubChem CID 876013) has the molecular formula C12H12N2O3
and a molecular weight of 232.24 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide.
Molecular Properties
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide |
| PubChem CID | 876013 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide |
| SMILES | CCC(=O)Nc1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C12H12N2O3/c1-3-10(15)13-7-4-5-8-9(6-7)12(17)14(2)11(8)16/h4-6H,3H2,1-2H3,(H,13,15) |
| InChIKey | HSZLBNWGPPCQRU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide?
The IUPAC name of N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide (CID 876013) is N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide.
What is the SMILES notation for N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide?
The canonical SMILES for N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide is CCC(=O)Nc1ccc2c(c1)C(=O)N(C)C2=O.
What is the InChIKey of N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide?
The InChIKey is HSZLBNWGPPCQRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-3-10(15)13-7-4-5-8-9(6-7)12(17)14(2)11(8)16/h4-6H,3H2,1-2H3,(H,13,15).
What are the key properties of N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide?
N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide has a molecular weight of 232.24 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide is sourced from PubChem (CID 876013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).