About 2-anthracen-9-ylethanol;2,2,2-trifluoroethanol
2-anthracen-9-ylethanol;2,2,2-trifluoroethanol (PubChem CID 87601320) has the molecular formula C18H17F3O2
and a molecular weight of 322.33 g/mol. Its IUPAC name is 2-anthracen-9-ylethanol;2,2,2-trifluoroethanol.
Molecular Properties
| Compound Name | 2-anthracen-9-ylethanol;2,2,2-trifluoroethanol |
| PubChem CID | 87601320 |
| Molecular Formula | C18H17F3O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-anthracen-9-ylethanol;2,2,2-trifluoroethanol |
| SMILES | OCC(F)(F)F.OCCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C16H14O.C2H3F3O/c17-10-9-16-14-7-3-1-5-12(14)11-13-6-2-4-8-15(13)16;3-2(4,5)1-6/h1-8,11,17H,9-10H2;6H,1H2 |
| InChIKey | CWRYIYRLIMSTEV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-anthracen-9-ylethanol;2,2,2-trifluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anthracen-9-ylethanol;2,2,2-trifluoroethanol?
The IUPAC name of 2-anthracen-9-ylethanol;2,2,2-trifluoroethanol (CID 87601320) is 2-anthracen-9-ylethanol;2,2,2-trifluoroethanol.
What is the SMILES notation for 2-anthracen-9-ylethanol;2,2,2-trifluoroethanol?
The canonical SMILES for 2-anthracen-9-ylethanol;2,2,2-trifluoroethanol is OCC(F)(F)F.OCCc1c2ccccc2cc2ccccc12.
What is the InChIKey of 2-anthracen-9-ylethanol;2,2,2-trifluoroethanol?
The InChIKey is CWRYIYRLIMSTEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O.C2H3F3O/c17-10-9-16-14-7-3-1-5-12(14)11-13-6-2-4-8-15(13)16;3-2(4,5)1-6/h1-8,11,17H,9-10H2;6H,1H2.
What are the key properties of 2-anthracen-9-ylethanol;2,2,2-trifluoroethanol?
2-anthracen-9-ylethanol;2,2,2-trifluoroethanol has a molecular weight of 322.33 g/mol, XLogP of 4.07, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anthracen-9-ylethanol;2,2,2-trifluoroethanol is sourced from PubChem (CID 87601320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).