C38H22F24O2P2 — CID 87601341
[(1R,2R)-2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyloxycyclohexyl]oxy-bis[3,5-bis(trifluoromethyl)phenyl]phosphane (PubChem CID 87601341) has the molecular formula C38H22F24O2P2 and a molecular weight of 1028.49 g/mol. Its IUPAC name is [(1R,2R)-2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyloxycyclohexyl]oxy-bis[3,5-bis(trifluoromethyl)phenyl]phosphane.
| Compound Name | [(1R,2R)-2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyloxycyclohexyl]oxy-bis[3,5-bis(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 87601341 |
| Molecular Formula | C38H22F24O2P2 |
| Molecular Weight | 1028.49 g/mol |
| Exact Mass | 1028.07 |
| IUPAC Name | [(1R,2R)-2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyloxycyclohexyl]oxy-bis[3,5-bis(trifluoromethyl)phenyl]phosphane |
| SMILES | FC(F)(F)c1cc(P(O[C@@H]2CCCC[C@H]2OP(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C38H22F24O2P2/c39-31(40,41)17-5-18(32(42,43)44)10-25(9-17)65(26-11-19(33(45,46)47)6-20(12-26)34(48,49)50)63-29-3-1-2-4-30(29)64-66(27-13-21(35(51,52)53)7-22(14-27)36(54,55)56)28-15-23(37(57,58)59)8-24(16-28)38(60,61)62/h5-16,29-30H,1-4H2/t29-,30-/m1/s1 |
| InChIKey | XKSHCNIWRGZUGN-LOYHVIPDSA-N |
| XLogP | 14.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1028.49 |
| LogP ≤ 5 | 14.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|