About azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate
azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate (PubChem CID 87601349) has the molecular formula C17H27NO5S
and a molecular weight of 357.47 g/mol. Its IUPAC name is azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate |
| PubChem CID | 87601349 |
| Molecular Formula | C17H27NO5S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCC(CC2CO2)CC2CO2)cc1.N |
| InChI | InChI=1S/C17H24O5S.H3N/c1-13-4-6-17(7-5-13)23(18,19)22-8-2-3-14(9-15-11-20-15)10-16-12-21-16;/h4-7,14-16H,2-3,8-12H2,1H3;1H3 |
| InChIKey | GIJSYQSXXZFJGS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate?
The IUPAC name of azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate (CID 87601349) is azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate.
What is the SMILES notation for azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate?
The canonical SMILES for azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCCC(CC2CO2)CC2CO2)cc1.N.
What is the InChIKey of azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate?
The InChIKey is GIJSYQSXXZFJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O5S.H3N/c1-13-4-6-17(7-5-13)23(18,19)22-8-2-3-14(9-15-11-20-15)10-16-12-21-16;/h4-7,14-16H,2-3,8-12H2,1H3;1H3.
What are the key properties of azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate?
azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate has a molecular weight of 357.47 g/mol, XLogP of 2.84, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 87601349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).