C54H64N10O6 — CID 87601419
bis[2-(dimethylamino)-1-[(3S)-3-[2-[4-(1H-indol-5-yl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]-2-oxoethyl] oxalate (PubChem CID 87601419) has the molecular formula C54H64N10O6 and a molecular weight of 949.17 g/mol. Its IUPAC name is bis[2-(dimethylamino)-1-[(3S)-3-[2-[4-(1H-indol-5-yl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]-2-oxoethyl] oxalate.
| Compound Name | bis[2-(dimethylamino)-1-[(3S)-3-[2-[4-(1H-indol-5-yl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]-2-oxoethyl] oxalate |
|---|---|
| PubChem CID | 87601419 |
| Molecular Formula | C54H64N10O6 |
| Molecular Weight | 949.17 g/mol |
| Exact Mass | 948.50 |
| IUPAC Name | bis[2-(dimethylamino)-1-[(3S)-3-[2-[4-(1H-indol-5-yl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]-2-oxoethyl] oxalate |
| SMILES | CN(C)C(=O)C(OC(=O)C(=O)OC(C(=O)N(C)C)N1C[C@@H](CCN2CCN(c3ccc4[nH]ccc4c3)CC2)c2ccccc21)N1C[C@@H](CCN2CCN(c3ccc4[nH]ccc4c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C54H64N10O6/c1-57(2)49(65)51(63-35-39(43-9-5-7-11-47(43)63)19-23-59-25-29-61(30-26-59)41-13-15-45-37(33-41)17-21-55-45)69-53(67)54(68)70-52(50(66)58(3)4)64-36-40(44-10-6-8-12-48(44)64)20-24-60-27-31-62(32-28-60)42-14-16-46-38(34-42)18-22-56-46/h5-18,21-22,33-34,39-40,51-52,55-56H,19-20,23-32,35-36H2,1-4H3/t39-,40-,51?,52?/m1/s1 |
| InChIKey | UNYJXMMPRPKOLP-PLJPLSJFSA-N |
| XLogP | 5.50 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.17 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|